C11H15F3O2 — CID 58935190
3-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1-trifluoropropan-2-ol (PubChem CID 58935190) has the molecular formula C11H15F3O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 58935190 |
| Molecular Formula | C11H15F3O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethoxy)-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(COCC1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O2/c12-11(13,14)10(15)6-16-5-9-4-7-1-2-8(9)3-7/h1-2,7-10,15H,3-6H2 |
| InChIKey | ITSYWODSWMVLAV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|