C9H3F18N — CID 165176683
1,1,1,3,3,3-hexafluoro-N,N-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)propan-2-amine (PubChem CID 165176683) has the molecular formula C9H3F18N and a molecular weight of 467.09 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-N,N-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)propan-2-amine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-N,N-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 165176683 |
| Molecular Formula | C9H3F18N |
| Molecular Weight | 467.09 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-N,N-bis(1,1,1,3,3,3-hexafluoropropan-2-yl)propan-2-amine |
| SMILES | FC(F)(F)C(N(C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F18N/c10-4(11,12)1(5(13,14)15)28(2(6(16,17)18)7(19,20)21)3(8(22,23)24)9(25,26)27/h1-3H |
| InChIKey | UEQDIXMOCQURFJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.09 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |