C3H4BF6LiO4 — CID 158113014
lithium;boric acid;1,1,1,3,3,3-hexafluoropropan-2-olate (PubChem CID 158113014) has the molecular formula C3H4BF6LiO4 and a molecular weight of 235.80 g/mol. Its IUPAC name is lithium;boric acid;1,1,1,3,3,3-hexafluoropropan-2-olate.
| Compound Name | lithium;boric acid;1,1,1,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 158113014 |
| Molecular Formula | C3H4BF6LiO4 |
| Molecular Weight | 235.80 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | lithium;boric acid;1,1,1,3,3,3-hexafluoropropan-2-olate |
| SMILES | OB(O)O.[Li+].[O-]C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3HF6O.BH3O3.Li/c4-2(5,6)1(10)3(7,8)9;2-1(3)4;/h1H;2-4H;/q-1;;+1 |
| InChIKey | FQQZOTPXBYDTDP-UHFFFAOYSA-N |
| XLogP | -4.21 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.80 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|