About lithium;boric acid;trifluoromethanolate
lithium;boric acid;trifluoromethanolate (PubChem CID 159254971) has the molecular formula CH3BF3LiO4
and a molecular weight of 153.78 g/mol. Its IUPAC name is lithium;boric acid;trifluoromethanolate.
Molecular Properties
| Compound Name | lithium;boric acid;trifluoromethanolate |
| PubChem CID | 159254971 |
| Molecular Formula | CH3BF3LiO4 |
| Molecular Weight | 153.78 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | lithium;boric acid;trifluoromethanolate |
| SMILES | OB(O)O.[Li+].[O-]C(F)(F)F |
| InChI | InChI=1S/CF3O.BH3O3.Li/c2-1(3,4)5;2-1(3)4;/h;2-4H;/q-1;;+1 |
| InChIKey | KVTVMDHTONEJQY-UHFFFAOYSA-N |
| XLogP | -5.18 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.78 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;boric acid;trifluoromethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;boric acid;trifluoromethanolate?
The IUPAC name of lithium;boric acid;trifluoromethanolate (CID 159254971) is lithium;boric acid;trifluoromethanolate.
What is the SMILES notation for lithium;boric acid;trifluoromethanolate?
The canonical SMILES for lithium;boric acid;trifluoromethanolate is OB(O)O.[Li+].[O-]C(F)(F)F.
What is the InChIKey of lithium;boric acid;trifluoromethanolate?
The InChIKey is KVTVMDHTONEJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/CF3O.BH3O3.Li/c2-1(3,4)5;2-1(3)4;/h;2-4H;/q-1;;+1.
What are the key properties of lithium;boric acid;trifluoromethanolate?
lithium;boric acid;trifluoromethanolate has a molecular weight of 153.78 g/mol, XLogP of -5.18, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;boric acid;trifluoromethanolate is sourced from PubChem (CID 159254971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).