C12H15F8NO — CID 160565386
2-methyl-4-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)-6-(trifluoromethyl)morpholine (PubChem CID 160565386) has the molecular formula C12H15F8NO and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-methyl-4-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)-6-(trifluoromethyl)morpholine.
| Compound Name | 2-methyl-4-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)-6-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 160565386 |
| Molecular Formula | C12H15F8NO |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-methyl-4-(4,4,5,5,5-pentafluoro-2-methylpent-2-en-3-yl)-6-(trifluoromethyl)morpholine |
| SMILES | CC(C)=C(N1CC(C)OC(C(F)(F)F)C1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F8NO/c1-6(2)9(10(13,14)12(18,19)20)21-4-7(3)22-8(5-21)11(15,16)17/h7-8H,4-5H2,1-3H3 |
| InChIKey | GIPTZXSZAABFLT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|