C15H16F3NO5 — CID 138032586
2-[3-[2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]phenoxy]acetic acid (PubChem CID 138032586) has the molecular formula C15H16F3NO5 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2-[3-[2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 138032586 |
| Molecular Formula | C15H16F3NO5 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[3-[2-methyl-6-(trifluoromethyl)morpholine-4-carbonyl]phenoxy]acetic acid |
| SMILES | CC1CN(C(=O)c2cccc(OCC(=O)O)c2)CC(C(F)(F)F)O1 |
| InChI | InChI=1S/C15H16F3NO5/c1-9-6-19(7-12(24-9)15(16,17)18)14(22)10-3-2-4-11(5-10)23-8-13(20)21/h2-5,9,12H,6-8H2,1H3,(H,20,21) |
| InChIKey | GXUOPFRRELHIOJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |