C19H19NO4 — CID 119187127
2-[3-(3-methyl-2-phenylazetidine-1-carbonyl)phenoxy]acetic acid (PubChem CID 119187127) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[3-(3-methyl-2-phenylazetidine-1-carbonyl)phenoxy]acetic acid.
| Compound Name | 2-[3-(3-methyl-2-phenylazetidine-1-carbonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 119187127 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[3-(3-methyl-2-phenylazetidine-1-carbonyl)phenoxy]acetic acid |
| SMILES | CC1CN(C(=O)c2cccc(OCC(=O)O)c2)C1c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c1-13-11-20(18(13)14-6-3-2-4-7-14)19(23)15-8-5-9-16(10-15)24-12-17(21)22/h2-10,13,18H,11-12H2,1H3,(H,21,22) |
| InChIKey | LGKRQTUOJFJKPU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |