C14H15F14NO — CID 130418367
1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-4-(trifluoromethyl)piperidine (PubChem CID 130418367) has the molecular formula C14H15F14NO and a molecular weight of 479.25 g/mol. Its IUPAC name is 1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130418367 |
| Molecular Formula | C14H15F14NO |
| Molecular Weight | 479.25 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 1-[1,1,1,3,3-pentafluoro-4-(2,2,3,4,4,4-hexafluorobutoxy)butan-2-yl]-4-(trifluoromethyl)piperidine |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(F)C(N1CCC(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H15F14NO/c15-8(13(23,24)25)10(16,17)5-30-6-11(18,19)9(14(26,27)28)29-3-1-7(2-4-29)12(20,21)22/h7-9H,1-6H2 |
| InChIKey | CNZPJSZEQRMOMG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |