C11H10F12O2 — CID 15503701
1,3-bis(1,1,2,3,3,3-hexafluoropropyl)cyclopentane-1,3-diol (PubChem CID 15503701) has the molecular formula C11H10F12O2 and a molecular weight of 402.18 g/mol. Its IUPAC name is 1,3-bis(1,1,2,3,3,3-hexafluoropropyl)cyclopentane-1,3-diol.
| Compound Name | 1,3-bis(1,1,2,3,3,3-hexafluoropropyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 15503701 |
| Molecular Formula | C11H10F12O2 |
| Molecular Weight | 402.18 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 1,3-bis(1,1,2,3,3,3-hexafluoropropyl)cyclopentane-1,3-diol |
| SMILES | OC1(C(F)(F)C(F)C(F)(F)F)CCC(O)(C(F)(F)C(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H10F12O2/c12-4(10(18,19)20)8(14,15)6(24)1-2-7(25,3-6)9(16,17)5(13)11(21,22)23/h4-5,24-25H,1-3H2 |
| InChIKey | YLGWJMKYSVJCNH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.18 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |