C13H17F6N — CID 2330402
(5S,7R)-3-[(2S)-1,1,2,3,3,3-hexafluoropropyl]adamantan-1-amine (PubChem CID 2330402) has the molecular formula C13H17F6N and a molecular weight of 301.27 g/mol. Its IUPAC name is (5S,7R)-3-[(2S)-1,1,2,3,3,3-hexafluoropropyl]adamantan-1-amine.
| Compound Name | (5S,7R)-3-[(2S)-1,1,2,3,3,3-hexafluoropropyl]adamantan-1-amine |
|---|---|
| PubChem CID | 2330402 |
| Molecular Formula | C13H17F6N |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (5S,7R)-3-[(2S)-1,1,2,3,3,3-hexafluoropropyl]adamantan-1-amine |
| SMILES | NC12C[C@H]3C[C@@H](C1)CC(C(F)(F)[C@H](F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C13H17F6N/c14-9(13(17,18)19)12(15,16)10-2-7-1-8(3-10)5-11(20,4-7)6-10/h7-9H,1-6,20H2/t7-,8+,9-,10?,11?/m0/s1 |
| InChIKey | WGKDOLVCXSFLIV-HHSKQIGOSA-N |
| XLogP | 3.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |