C11H13F12NO — CID 137474496
N,1,1,1,3,3-hexafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylpentan-2-amine (PubChem CID 137474496) has the molecular formula C11H13F12NO and a molecular weight of 403.21 g/mol. Its IUPAC name is N,1,1,1,3,3-hexafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylpentan-2-amine.
| Compound Name | N,1,1,1,3,3-hexafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 137474496 |
| Molecular Formula | C11H13F12NO |
| Molecular Weight | 403.21 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N,1,1,1,3,3-hexafluoro-4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N-methylpentan-2-amine |
| SMILES | CC(OC(C)C(F)(F)C(N(C)F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F12NO/c1-4(8(13,14)6(12)10(17,18)19)25-5(2)9(15,16)7(24(3)23)11(20,21)22/h4-7H,1-3H3 |
| InChIKey | ZQRCWUSYUWKXHI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|