C12H9F6NO — CID 162536204
4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)benzonitrile (PubChem CID 162536204) has the molecular formula C12H9F6NO and a molecular weight of 297.20 g/mol. Its IUPAC name is 4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)benzonitrile.
| Compound Name | 4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)benzonitrile |
|---|---|
| PubChem CID | 162536204 |
| Molecular Formula | C12H9F6NO |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)benzonitrile |
| SMILES | CC(Oc1ccc(C#N)cc1)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H9F6NO/c1-7(11(14,15)10(13)12(16,17)18)20-9-4-2-8(6-19)3-5-9/h2-5,7,10H,1H3 |
| InChIKey | CJKYWXWOJOXJTJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |