C10H8F3NO — CID 175544534
4-(1,1,3-trifluoropropan-2-yloxy)benzonitrile (PubChem CID 175544534) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 4-(1,1,3-trifluoropropan-2-yloxy)benzonitrile.
| Compound Name | 4-(1,1,3-trifluoropropan-2-yloxy)benzonitrile |
|---|---|
| PubChem CID | 175544534 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-(1,1,3-trifluoropropan-2-yloxy)benzonitrile |
| SMILES | N#Cc1ccc(OC(CF)C(F)F)cc1 |
| InChI | InChI=1S/C10H8F3NO/c11-5-9(10(12)13)15-8-3-1-7(6-14)2-4-8/h1-4,9-10H,5H2 |
| InChIKey | LXXOQTNVDHZBCI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |