C14H17F17O3Si — CID 158558916
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(dimethoxy)silane;methoxymethane (PubChem CID 158558916) has the molecular formula C14H17F17O3Si and a molecular weight of 584.34 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(dimethoxy)silane;methoxymethane.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(dimethoxy)silane;methoxymethane |
|---|---|
| PubChem CID | 158558916 |
| Molecular Formula | C14H17F17O3Si |
| Molecular Weight | 584.34 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(dimethoxy)silane;methoxymethane |
| SMILES | COC.CO[SiH](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C12H11F17O2Si.C2H6O/c1-30-32(31-2)4-3-5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29;1-3-2/h32H,3-4H2,1-2H3;1-2H3 |
| InChIKey | HQQFWOXSBOYWKA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.34 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|