C6H11F5Si — CID 172840662
dimethyl(3,3,4,4,4-pentafluorobutyl)silane (PubChem CID 172840662) has the molecular formula C6H11F5Si and a molecular weight of 206.23 g/mol. Its IUPAC name is dimethyl(3,3,4,4,4-pentafluorobutyl)silane.
| Compound Name | dimethyl(3,3,4,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 172840662 |
| Molecular Formula | C6H11F5Si |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | dimethyl(3,3,4,4,4-pentafluorobutyl)silane |
| SMILES | C[SiH](C)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H11F5Si/c1-12(2)4-3-5(7,8)6(9,10)11/h12H,3-4H2,1-2H3 |
| InChIKey | WTCHRYMLOVUGKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|