C13H23F5N2Si — CID 140503768
3,3,4,4,4-pentafluorobutyl-piperidin-1-yl-pyrrolidin-1-ylsilane (PubChem CID 140503768) has the molecular formula C13H23F5N2Si and a molecular weight of 330.42 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluorobutyl-piperidin-1-yl-pyrrolidin-1-ylsilane.
| Compound Name | 3,3,4,4,4-pentafluorobutyl-piperidin-1-yl-pyrrolidin-1-ylsilane |
|---|---|
| PubChem CID | 140503768 |
| Molecular Formula | C13H23F5N2Si |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3,3,4,4,4-pentafluorobutyl-piperidin-1-yl-pyrrolidin-1-ylsilane |
| SMILES | FC(F)(F)C(F)(F)CC[SiH](N1CCCCC1)N1CCCC1 |
| InChI | InChI=1S/C13H23F5N2Si/c14-12(15,13(16,17)18)6-11-21(20-9-4-5-10-20)19-7-2-1-3-8-19/h21H,1-11H2 |
| InChIKey | PGSMEDOFNXCSLQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|