About propan-2-yloxysilane;trimethoxysilane
propan-2-yloxysilane;trimethoxysilane (PubChem CID 174416098) has the molecular formula C6H20O4Si2
and a molecular weight of 212.39 g/mol. Its IUPAC name is propan-2-yloxysilane;trimethoxysilane.
Molecular Properties
| Compound Name | propan-2-yloxysilane;trimethoxysilane |
| PubChem CID | 174416098 |
| Molecular Formula | C6H20O4Si2 |
| Molecular Weight | 212.39 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | propan-2-yloxysilane;trimethoxysilane |
| SMILES | CC(C)O[SiH3].CO[SiH](OC)OC |
| InChI | InChI=1S/C3H10O3Si.C3H10OSi/c1-4-7(5-2)6-3;1-3(2)4-5/h7H,1-3H3;3H,1-2,5H3 |
| InChIKey | WHFZWGXIHHLDGZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.39 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxysilane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxysilane;trimethoxysilane?
The IUPAC name of propan-2-yloxysilane;trimethoxysilane (CID 174416098) is propan-2-yloxysilane;trimethoxysilane.
What is the SMILES notation for propan-2-yloxysilane;trimethoxysilane?
The canonical SMILES for propan-2-yloxysilane;trimethoxysilane is CC(C)O[SiH3].CO[SiH](OC)OC.
What is the InChIKey of propan-2-yloxysilane;trimethoxysilane?
The InChIKey is WHFZWGXIHHLDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C3H10OSi/c1-4-7(5-2)6-3;1-3(2)4-5/h7H,1-3H3;3H,1-2,5H3.
What are the key properties of propan-2-yloxysilane;trimethoxysilane?
propan-2-yloxysilane;trimethoxysilane has a molecular weight of 212.39 g/mol, XLogP of -0.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxysilane;trimethoxysilane is sourced from PubChem (CID 174416098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).