About 1-chloroethoxysilane
1-chloroethoxysilane (PubChem CID 71329388) has the molecular formula C2H7ClOSi
and a molecular weight of 110.62 g/mol. Its IUPAC name is 1-chloroethoxysilane.
Molecular Properties
| Compound Name | 1-chloroethoxysilane |
| PubChem CID | 71329388 |
| Molecular Formula | C2H7ClOSi |
| Molecular Weight | 110.62 g/mol |
| Exact Mass | 110.00 |
| IUPAC Name | 1-chloroethoxysilane |
| SMILES | CC(Cl)O[SiH3] |
| InChI | InChI=1S/C2H7ClOSi/c1-2(3)4-5/h2H,1,5H3 |
| InChIKey | CDVHLNOKUAKGIV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.62 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethoxysilane?
The IUPAC name of 1-chloroethoxysilane (CID 71329388) is 1-chloroethoxysilane.
What is the SMILES notation for 1-chloroethoxysilane?
The canonical SMILES for 1-chloroethoxysilane is CC(Cl)O[SiH3].
What is the InChIKey of 1-chloroethoxysilane?
The InChIKey is CDVHLNOKUAKGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7ClOSi/c1-2(3)4-5/h2H,1,5H3.
What are the key properties of 1-chloroethoxysilane?
1-chloroethoxysilane has a molecular weight of 110.62 g/mol, XLogP of -0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethoxysilane is sourced from PubChem (CID 71329388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).