About (1-Chloroethoxy)silane
(1-Chloroethoxy)silane (PubChem CID 23045874) has the molecular formula C2H4ClOSi
and a molecular weight of 107.59 g/mol.
Molecular Properties
| Compound Name | (1-Chloroethoxy)silane |
| PubChem CID | 23045874 |
| Molecular Formula | C2H4ClOSi |
| Molecular Weight | 107.59 g/mol |
| Exact Mass | 106.97 |
| IUPAC Name | — |
| SMILES | CC(Cl)O[Si] |
| InChI | InChI=1S/C2H4ClOSi/c1-2(3)4-5/h2H,1H3 |
| InChIKey | JZMLUJUXNCBGCU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.59 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-Chloroethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-Chloroethoxy)silane?
The IUPAC name of (1-Chloroethoxy)silane (CID 23045874) is not available.
What is the SMILES notation for (1-Chloroethoxy)silane?
The canonical SMILES for (1-Chloroethoxy)silane is CC(Cl)O[Si].
What is the InChIKey of (1-Chloroethoxy)silane?
The InChIKey is JZMLUJUXNCBGCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClOSi/c1-2(3)4-5/h2H,1H3.
What are the key properties of (1-Chloroethoxy)silane?
(1-Chloroethoxy)silane has a molecular weight of 107.59 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-Chloroethoxy)silane is sourced from PubChem (CID 23045874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).