About propan-2-yloxysilane;hydrochloride
propan-2-yloxysilane;hydrochloride (PubChem CID 174499171) has the molecular formula C3H11ClOSi
and a molecular weight of 126.66 g/mol. Its IUPAC name is propan-2-yloxysilane;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yloxysilane;hydrochloride |
| PubChem CID | 174499171 |
| Molecular Formula | C3H11ClOSi |
| Molecular Weight | 126.66 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | propan-2-yloxysilane;hydrochloride |
| SMILES | CC(C)O[SiH3].Cl |
| InChI | InChI=1S/C3H10OSi.ClH/c1-3(2)4-5;/h3H,1-2,5H3;1H |
| InChIKey | RBVMGBDBZNIWAA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.66 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxysilane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxysilane;hydrochloride?
The IUPAC name of propan-2-yloxysilane;hydrochloride (CID 174499171) is propan-2-yloxysilane;hydrochloride.
What is the SMILES notation for propan-2-yloxysilane;hydrochloride?
The canonical SMILES for propan-2-yloxysilane;hydrochloride is CC(C)O[SiH3].Cl.
What is the InChIKey of propan-2-yloxysilane;hydrochloride?
The InChIKey is RBVMGBDBZNIWAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10OSi.ClH/c1-3(2)4-5;/h3H,1-2,5H3;1H.
What are the key properties of propan-2-yloxysilane;hydrochloride?
propan-2-yloxysilane;hydrochloride has a molecular weight of 126.66 g/mol, XLogP of 0.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxysilane;hydrochloride is sourced from PubChem (CID 174499171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).