C11H33NOSi3 — CID 173078026
N,N-bis(trimethylsilyl)ethanamine;propan-2-yloxysilane (PubChem CID 173078026) has the molecular formula C11H33NOSi3 and a molecular weight of 279.65 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)ethanamine;propan-2-yloxysilane.
| Compound Name | N,N-bis(trimethylsilyl)ethanamine;propan-2-yloxysilane |
|---|---|
| PubChem CID | 173078026 |
| Molecular Formula | C11H33NOSi3 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | N,N-bis(trimethylsilyl)ethanamine;propan-2-yloxysilane |
| SMILES | CC(C)O[SiH3].CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C8H23NSi2.C3H10OSi/c1-8-9(10(2,3)4)11(5,6)7;1-3(2)4-5/h8H2,1-7H3;3H,1-2,5H3 |
| InChIKey | IIZVLNAZELQECE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|