C13H32N2Si2 — CID 164788354
N-[(2,5-dimethylpyrrolidin-1-yl)-dimethylsilyl]-N-trimethylsilylethanamine (PubChem CID 164788354) has the molecular formula C13H32N2Si2 and a molecular weight of 272.58 g/mol. Its IUPAC name is N-[(2,5-dimethylpyrrolidin-1-yl)-dimethylsilyl]-N-trimethylsilylethanamine.
| Compound Name | N-[(2,5-dimethylpyrrolidin-1-yl)-dimethylsilyl]-N-trimethylsilylethanamine |
|---|---|
| PubChem CID | 164788354 |
| Molecular Formula | C13H32N2Si2 |
| Molecular Weight | 272.58 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-[(2,5-dimethylpyrrolidin-1-yl)-dimethylsilyl]-N-trimethylsilylethanamine |
| SMILES | CCN([Si](C)(C)C)[Si](C)(C)N1C(C)CCC1C |
| InChI | InChI=1S/C13H32N2Si2/c1-9-14(16(4,5)6)17(7,8)15-12(2)10-11-13(15)3/h12-13H,9-11H2,1-8H3 |
| InChIKey | LUQHTEBPJPLPPM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|