C11H20N4O — CID 116808240
5-(azepan-2-yl)-N-ethyl-N-methyl-1,2,4-oxadiazol-3-amine (PubChem CID 116808240) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 5-(azepan-2-yl)-N-ethyl-N-methyl-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(azepan-2-yl)-N-ethyl-N-methyl-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 116808240 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 5-(azepan-2-yl)-N-ethyl-N-methyl-1,2,4-oxadiazol-3-amine |
| SMILES | CCN(C)c1noc(C2CCCCCN2)n1 |
| InChI | InChI=1S/C11H20N4O/c1-3-15(2)11-13-10(16-14-11)9-7-5-4-6-8-12-9/h9,12H,3-8H2,1-2H3 |
| InChIKey | VKUZKQYAMGXMIY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |