C12H35NOSi3 — CID 173078040
N,N-bis(trimethylsilyl)ethanamine;(2-methylpropan-2-yl)oxysilane (PubChem CID 173078040) has the molecular formula C12H35NOSi3 and a molecular weight of 293.68 g/mol. Its IUPAC name is N,N-bis(trimethylsilyl)ethanamine;(2-methylpropan-2-yl)oxysilane.
| Compound Name | N,N-bis(trimethylsilyl)ethanamine;(2-methylpropan-2-yl)oxysilane |
|---|---|
| PubChem CID | 173078040 |
| Molecular Formula | C12H35NOSi3 |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N,N-bis(trimethylsilyl)ethanamine;(2-methylpropan-2-yl)oxysilane |
| SMILES | CC(C)(C)O[SiH3].CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C8H23NSi2.C4H12OSi/c1-8-9(10(2,3)4)11(5,6)7;1-4(2,3)5-6/h8H2,1-7H3;1-3,6H3 |
| InChIKey | WPFLPOHSSGUZQS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|