C14H30O4Si — CID 175205036
1,6-diethoxy-7-oxabicyclo[4.1.0]heptane;(2-methylpropan-2-yl)oxysilane (PubChem CID 175205036) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 1,6-diethoxy-7-oxabicyclo[4.1.0]heptane;(2-methylpropan-2-yl)oxysilane.
| Compound Name | 1,6-diethoxy-7-oxabicyclo[4.1.0]heptane;(2-methylpropan-2-yl)oxysilane |
|---|---|
| PubChem CID | 175205036 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1,6-diethoxy-7-oxabicyclo[4.1.0]heptane;(2-methylpropan-2-yl)oxysilane |
| SMILES | CC(C)(C)O[SiH3].CCOC12CCCCC1(OCC)O2 |
| InChI | InChI=1S/C10H18O3.C4H12OSi/c1-3-11-9-7-5-6-8-10(9,13-9)12-4-2;1-4(2,3)5-6/h3-8H2,1-2H3;1-3,6H3 |
| InChIKey | KUGSEWUXGPHMCM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|