C21H54N2OSi4 — CID 123204071
N-(4-methyl-4-silyloxypentyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine (PubChem CID 123204071) has the molecular formula C21H54N2OSi4 and a molecular weight of 463.02 g/mol. Its IUPAC name is N-(4-methyl-4-silyloxypentyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine.
| Compound Name | N-(4-methyl-4-silyloxypentyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 123204071 |
| Molecular Formula | C21H54N2OSi4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | N-(4-methyl-4-silyloxypentyl)-N,N',N'-tris(trimethylsilyl)hexane-1,6-diamine |
| SMILES | CC(C)(CCCN(CCCCCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C)O[SiH3] |
| InChI | InChI=1S/C21H54N2OSi4/c1-21(2,24-25)17-16-19-22(26(3,4)5)18-14-12-13-15-20-23(27(6,7)8)28(9,10)11/h12-20H2,1-11,25H3 |
| InChIKey | RKQCXBLQUPIQKQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|