C19H39NO6Si2 — CID 87248731
triethyl 4-[bis(trimethylsilyl)amino]butane-1,1,1-tricarboxylate (PubChem CID 87248731) has the molecular formula C19H39NO6Si2 and a molecular weight of 433.69 g/mol. Its IUPAC name is triethyl 4-[bis(trimethylsilyl)amino]butane-1,1,1-tricarboxylate.
| Compound Name | triethyl 4-[bis(trimethylsilyl)amino]butane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 87248731 |
| Molecular Formula | C19H39NO6Si2 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | triethyl 4-[bis(trimethylsilyl)amino]butane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(CCCN([Si](C)(C)C)[Si](C)(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H39NO6Si2/c1-10-24-16(21)19(17(22)25-11-2,18(23)26-12-3)14-13-15-20(27(4,5)6)28(7,8)9/h10-15H2,1-9H3 |
| InChIKey | MJAZHSHUPHMWKF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|