C18H46N2Si3 — CID 139747027
N-methyl-N,N',N'-tris(trimethylsilyl)octane-1,8-diamine (PubChem CID 139747027) has the molecular formula C18H46N2Si3 and a molecular weight of 374.84 g/mol. Its IUPAC name is N-methyl-N,N',N'-tris(trimethylsilyl)octane-1,8-diamine.
| Compound Name | N-methyl-N,N',N'-tris(trimethylsilyl)octane-1,8-diamine |
|---|---|
| PubChem CID | 139747027 |
| Molecular Formula | C18H46N2Si3 |
| Molecular Weight | 374.84 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | N-methyl-N,N',N'-tris(trimethylsilyl)octane-1,8-diamine |
| SMILES | CN(CCCCCCCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H46N2Si3/c1-19(21(2,3)4)17-15-13-11-12-14-16-18-20(22(5,6)7)23(8,9)10/h11-18H2,1-10H3 |
| InChIKey | ZGCZRQSVKGRKNO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.84 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|