C14H36N2Si2 — CID 86178958
N,N'-dimethyl-N,N'-bis(trimethylsilyl)hexane-1,6-diamine (PubChem CID 86178958) has the molecular formula C14H36N2Si2 and a molecular weight of 288.63 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(trimethylsilyl)hexane-1,6-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis(trimethylsilyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 86178958 |
| Molecular Formula | C14H36N2Si2 |
| Molecular Weight | 288.63 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(trimethylsilyl)hexane-1,6-diamine |
| SMILES | CN(CCCCCCN(C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H36N2Si2/c1-15(17(3,4)5)13-11-9-10-12-14-16(2)18(6,7)8/h9-14H2,1-8H3 |
| InChIKey | MORWAFMOBHUWLK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|