C15H37NSi2 — CID 15257996
N-methyl-4-trimethylsilyl-N-(4-trimethylsilylbutyl)butan-1-amine (PubChem CID 15257996) has the molecular formula C15H37NSi2 and a molecular weight of 287.64 g/mol. Its IUPAC name is N-methyl-4-trimethylsilyl-N-(4-trimethylsilylbutyl)butan-1-amine.
| Compound Name | N-methyl-4-trimethylsilyl-N-(4-trimethylsilylbutyl)butan-1-amine |
|---|---|
| PubChem CID | 15257996 |
| Molecular Formula | C15H37NSi2 |
| Molecular Weight | 287.64 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | N-methyl-4-trimethylsilyl-N-(4-trimethylsilylbutyl)butan-1-amine |
| SMILES | CN(CCCC[Si](C)(C)C)CCCC[Si](C)(C)C |
| InChI | InChI=1S/C15H37NSi2/c1-16(12-8-10-14-17(2,3)4)13-9-11-15-18(5,6)7/h8-15H2,1-7H3 |
| InChIKey | SABIDPRIRKTSIE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|