C11H31NSi3 — CID 154186615
3-dimethylsilyl-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 154186615) has the molecular formula C11H31NSi3 and a molecular weight of 261.63 g/mol. Its IUPAC name is 3-dimethylsilyl-N,N-bis(trimethylsilyl)propan-1-amine.
| Compound Name | 3-dimethylsilyl-N,N-bis(trimethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 154186615 |
| Molecular Formula | C11H31NSi3 |
| Molecular Weight | 261.63 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3-dimethylsilyl-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | C[SiH](C)CCCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H31NSi3/c1-13(2)11-9-10-12(14(3,4)5)15(6,7)8/h13H,9-11H2,1-8H3 |
| InChIKey | AYUFSLJFYAKJGW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|