C14H35NSi2 — CID 87092377
N,N-bis(triethylsilyl)ethanamine (PubChem CID 87092377) has the molecular formula C14H35NSi2 and a molecular weight of 273.61 g/mol. Its IUPAC name is N,N-bis(triethylsilyl)ethanamine.
| Compound Name | N,N-bis(triethylsilyl)ethanamine |
|---|---|
| PubChem CID | 87092377 |
| Molecular Formula | C14H35NSi2 |
| Molecular Weight | 273.61 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | N,N-bis(triethylsilyl)ethanamine |
| SMILES | CCN([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C14H35NSi2/c1-8-15(16(9-2,10-3)11-4)17(12-5,13-6)14-7/h8-14H2,1-7H3 |
| InChIKey | ACDZIRHEDPHMRS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|