C20H51NO2Si3 — CID 173005185
N,N-bis(triethylsilyl)butan-1-amine;diethoxysilane (PubChem CID 173005185) has the molecular formula C20H51NO2Si3 and a molecular weight of 421.89 g/mol. Its IUPAC name is N,N-bis(triethylsilyl)butan-1-amine;diethoxysilane.
| Compound Name | N,N-bis(triethylsilyl)butan-1-amine;diethoxysilane |
|---|---|
| PubChem CID | 173005185 |
| Molecular Formula | C20H51NO2Si3 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | N,N-bis(triethylsilyl)butan-1-amine;diethoxysilane |
| SMILES | CCCCN([Si](CC)(CC)CC)[Si](CC)(CC)CC.CCO[SiH2]OCC |
| InChI | InChI=1S/C16H39NSi2.C4H12O2Si/c1-8-15-16-17(18(9-2,10-3)11-4)19(12-5,13-6)14-7;1-3-5-7-6-4-2/h8-16H2,1-7H3;3-4,7H2,1-2H3 |
| InChIKey | VHIXJYZJGKTZSS-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|