C18H47NO2Si3 — CID 173005166
N,N-bis(triethylsilyl)butan-1-amine;dimethoxysilane (PubChem CID 173005166) has the molecular formula C18H47NO2Si3 and a molecular weight of 393.84 g/mol. Its IUPAC name is N,N-bis(triethylsilyl)butan-1-amine;dimethoxysilane.
| Compound Name | N,N-bis(triethylsilyl)butan-1-amine;dimethoxysilane |
|---|---|
| PubChem CID | 173005166 |
| Molecular Formula | C18H47NO2Si3 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | N,N-bis(triethylsilyl)butan-1-amine;dimethoxysilane |
| SMILES | CCCCN([Si](CC)(CC)CC)[Si](CC)(CC)CC.CO[SiH2]OC |
| InChI | InChI=1S/C16H39NSi2.C2H8O2Si/c1-8-15-16-17(18(9-2,10-3)11-4)19(12-5,13-6)14-7;1-3-5-4-2/h8-16H2,1-7H3;5H2,1-2H3 |
| InChIKey | QTWMQXJZAJMRKE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|