C9H25NO2Si — CID 173222113
diethoxysilane;N,N-dimethylpropan-1-amine (PubChem CID 173222113) has the molecular formula C9H25NO2Si and a molecular weight of 207.39 g/mol. Its IUPAC name is diethoxysilane;N,N-dimethylpropan-1-amine.
| Compound Name | diethoxysilane;N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 173222113 |
| Molecular Formula | C9H25NO2Si |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | diethoxysilane;N,N-dimethylpropan-1-amine |
| SMILES | CCCN(C)C.CCO[SiH2]OCC |
| InChI | InChI=1S/C5H13N.C4H12O2Si/c1-4-5-6(2)3;1-3-5-7-6-4-2/h4-5H2,1-3H3;3-4,7H2,1-2H3 |
| InChIKey | KKZGERNCQKRWIX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|