C11H30N2 — CID 143587247
N,N-dimethylpropan-1-amine;ethane;N-ethylethanamine (PubChem CID 143587247) has the molecular formula C11H30N2 and a molecular weight of 190.37 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;ethane;N-ethylethanamine.
| Compound Name | N,N-dimethylpropan-1-amine;ethane;N-ethylethanamine |
|---|---|
| PubChem CID | 143587247 |
| Molecular Formula | C11H30N2 |
| Molecular Weight | 190.37 g/mol |
| Exact Mass | 190.24 |
| IUPAC Name | N,N-dimethylpropan-1-amine;ethane;N-ethylethanamine |
| SMILES | CC.CCCN(C)C.CCNCC |
| InChI | InChI=1S/C5H13N.C4H11N.C2H6/c1-4-5-6(2)3;1-3-5-4-2;1-2/h4-5H2,1-3H3;5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | IZXZQFYKUZFCJU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |