About azane;N,N-diethylethanamine;N-ethylethanamine
azane;N,N-diethylethanamine;N-ethylethanamine (PubChem CID 172815091) has the molecular formula C10H29N3
and a molecular weight of 191.36 g/mol. Its IUPAC name is azane;N,N-diethylethanamine;N-ethylethanamine.
Molecular Properties
| Compound Name | azane;N,N-diethylethanamine;N-ethylethanamine |
| PubChem CID | 172815091 |
| Molecular Formula | C10H29N3 |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.24 |
| IUPAC Name | azane;N,N-diethylethanamine;N-ethylethanamine |
| SMILES | CCN(CC)CC.CCNCC.N |
| InChI | InChI=1S/C6H15N.C4H11N.H3N/c1-4-7(5-2)6-3;1-3-5-4-2;/h4-6H2,1-3H3;5H,3-4H2,1-2H3;1H3 |
| InChIKey | SRYRURZOGNQYGW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;N,N-diethylethanamine;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N,N-diethylethanamine;N-ethylethanamine?
The IUPAC name of azane;N,N-diethylethanamine;N-ethylethanamine (CID 172815091) is azane;N,N-diethylethanamine;N-ethylethanamine.
What is the SMILES notation for azane;N,N-diethylethanamine;N-ethylethanamine?
The canonical SMILES for azane;N,N-diethylethanamine;N-ethylethanamine is CCN(CC)CC.CCNCC.N.
What is the InChIKey of azane;N,N-diethylethanamine;N-ethylethanamine?
The InChIKey is SRYRURZOGNQYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H11N.H3N/c1-4-7(5-2)6-3;1-3-5-4-2;/h4-6H2,1-3H3;5H,3-4H2,1-2H3;1H3.
What are the key properties of azane;N,N-diethylethanamine;N-ethylethanamine?
azane;N,N-diethylethanamine;N-ethylethanamine has a molecular weight of 191.36 g/mol, XLogP of 2.13, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N,N-diethylethanamine;N-ethylethanamine is sourced from PubChem (CID 172815091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).