About 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane
1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane (PubChem CID 173050421) has the molecular formula C8H22N2OSi
and a molecular weight of 190.36 g/mol. Its IUPAC name is 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane |
| PubChem CID | 173050421 |
| Molecular Formula | C8H22N2OSi |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane |
| SMILES | CC(C)O[SiH3].CC(N)C1CNC1 |
| InChI | InChI=1S/C5H12N2.C3H10OSi/c1-4(6)5-2-7-3-5;1-3(2)4-5/h4-5,7H,2-3,6H2,1H3;3H,1-2,5H3 |
| InChIKey | BFIFFSWEFYWLML-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane?
The IUPAC name of 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane (CID 173050421) is 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane.
What is the SMILES notation for 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane?
The canonical SMILES for 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane is CC(C)O[SiH3].CC(N)C1CNC1.
What is the InChIKey of 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane?
The InChIKey is BFIFFSWEFYWLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.C3H10OSi/c1-4(6)5-2-7-3-5;1-3(2)4-5/h4-5,7H,2-3,6H2,1H3;3H,1-2,5H3.
What are the key properties of 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane?
1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane has a molecular weight of 190.36 g/mol, XLogP of -0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)ethanamine;propan-2-yloxysilane is sourced from PubChem (CID 173050421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).