About 1-pyrrolidin-3-ylethanamine;triethoxysilane
1-pyrrolidin-3-ylethanamine;triethoxysilane (PubChem CID 173046931) has the molecular formula C12H30N2O3Si
and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-pyrrolidin-3-ylethanamine;triethoxysilane.
Molecular Properties
| Compound Name | 1-pyrrolidin-3-ylethanamine;triethoxysilane |
| PubChem CID | 173046931 |
| Molecular Formula | C12H30N2O3Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-pyrrolidin-3-ylethanamine;triethoxysilane |
| SMILES | CC(N)C1CCNC1.CCO[SiH](OCC)OCC |
| InChI | InChI=1S/C6H14N2.C6H16O3Si/c1-5(7)6-2-3-8-4-6;1-4-7-10(8-5-2)9-6-3/h5-6,8H,2-4,7H2,1H3;10H,4-6H2,1-3H3 |
| InChIKey | GGOJDPGOVLTFTM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-pyrrolidin-3-ylethanamine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-3-ylethanamine;triethoxysilane?
The IUPAC name of 1-pyrrolidin-3-ylethanamine;triethoxysilane (CID 173046931) is 1-pyrrolidin-3-ylethanamine;triethoxysilane.
What is the SMILES notation for 1-pyrrolidin-3-ylethanamine;triethoxysilane?
The canonical SMILES for 1-pyrrolidin-3-ylethanamine;triethoxysilane is CC(N)C1CCNC1.CCO[SiH](OCC)OCC.
What is the InChIKey of 1-pyrrolidin-3-ylethanamine;triethoxysilane?
The InChIKey is GGOJDPGOVLTFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C6H16O3Si/c1-5(7)6-2-3-8-4-6;1-4-7-10(8-5-2)9-6-3/h5-6,8H,2-4,7H2,1H3;10H,4-6H2,1-3H3.
What are the key properties of 1-pyrrolidin-3-ylethanamine;triethoxysilane?
1-pyrrolidin-3-ylethanamine;triethoxysilane has a molecular weight of 278.47 g/mol, XLogP of 0.76, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-3-ylethanamine;triethoxysilane is sourced from PubChem (CID 173046931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).