About CID 173018185
CID 173018185 (PubChem CID 173018185) has the molecular formula C3H10Cl3OSn
and a molecular weight of 287.18 g/mol.
Molecular Properties
| Compound Name | CID 173018185 |
| PubChem CID | 173018185 |
| Molecular Formula | C3H10Cl3OSn |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.88 |
| IUPAC Name | — |
| SMILES | CC(C)O[Sn].Cl.Cl.Cl |
| InChI | InChI=1S/C3H7O.3ClH.Sn/c1-3(2)4;;;;/h3H,1-2H3;3*1H;/q-1;;;;+1 |
| InChIKey | DKZZLDNZLNCVNV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 173018185 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173018185?
The IUPAC name of CID 173018185 (CID 173018185) is not available.
What is the SMILES notation for CID 173018185?
The canonical SMILES for CID 173018185 is CC(C)O[Sn].Cl.Cl.Cl.
What is the InChIKey of CID 173018185?
The InChIKey is DKZZLDNZLNCVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.3ClH.Sn/c1-3(2)4;;;;/h3H,1-2H3;3*1H;/q-1;;;;+1.
What are the key properties of CID 173018185?
CID 173018185 has a molecular weight of 287.18 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173018185 is sourced from PubChem (CID 173018185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).