About propan-2-yloxyazanium
propan-2-yloxyazanium (PubChem CID 3354244) has the molecular formula C3H10NO+
and a molecular weight of 76.12 g/mol. Its IUPAC name is propan-2-yloxyazanium.
Molecular Properties
| Compound Name | propan-2-yloxyazanium |
| PubChem CID | 3354244 |
| Molecular Formula | C3H10NO+ |
| Molecular Weight | 76.12 g/mol |
| Exact Mass | 76.08 |
| IUPAC Name | propan-2-yloxyazanium |
| SMILES | CC(C)O[NH3+] |
| InChI | InChI=1S/C3H10NO/c1-3(2)5-4/h3H,1-2,4H3/q+1 |
| InChIKey | DNPWQJCUNDTSCM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.12 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yloxyazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yloxyazanium?
The IUPAC name of propan-2-yloxyazanium (CID 3354244) is propan-2-yloxyazanium.
What is the SMILES notation for propan-2-yloxyazanium?
The canonical SMILES for propan-2-yloxyazanium is CC(C)O[NH3+].
What is the InChIKey of propan-2-yloxyazanium?
The InChIKey is DNPWQJCUNDTSCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10NO/c1-3(2)5-4/h3H,1-2,4H3/q+1.
What are the key properties of propan-2-yloxyazanium?
propan-2-yloxyazanium has a molecular weight of 76.12 g/mol, XLogP of -0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yloxyazanium is sourced from PubChem (CID 3354244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).