About tetrapropan-2-yl silicate;titanium
tetrapropan-2-yl silicate;titanium (PubChem CID 87401928) has the molecular formula C12H28O4SiTi
and a molecular weight of 312.31 g/mol. Its IUPAC name is tetrapropan-2-yl silicate;titanium.
Molecular Properties
| Compound Name | tetrapropan-2-yl silicate;titanium |
| PubChem CID | 87401928 |
| Molecular Formula | C12H28O4SiTi |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | tetrapropan-2-yl silicate;titanium |
| SMILES | CC(C)O[Si](OC(C)C)(OC(C)C)OC(C)C.[Ti] |
| InChI | InChI=1S/C12H28O4Si.Ti/c1-9(2)13-17(14-10(3)4,15-11(5)6)16-12(7)8;/h9-12H,1-8H3; |
| InChIKey | XNTGDFIIPWEJMQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetrapropan-2-yl silicate;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapropan-2-yl silicate;titanium?
The IUPAC name of tetrapropan-2-yl silicate;titanium (CID 87401928) is tetrapropan-2-yl silicate;titanium.
What is the SMILES notation for tetrapropan-2-yl silicate;titanium?
The canonical SMILES for tetrapropan-2-yl silicate;titanium is CC(C)O[Si](OC(C)C)(OC(C)C)OC(C)C.[Ti].
What is the InChIKey of tetrapropan-2-yl silicate;titanium?
The InChIKey is XNTGDFIIPWEJMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O4Si.Ti/c1-9(2)13-17(14-10(3)4,15-11(5)6)16-12(7)8;/h9-12H,1-8H3;.
What are the key properties of tetrapropan-2-yl silicate;titanium?
tetrapropan-2-yl silicate;titanium has a molecular weight of 312.31 g/mol, XLogP of 3.12, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapropan-2-yl silicate;titanium is sourced from PubChem (CID 87401928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).