About tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane
tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane (PubChem CID 139180214) has the molecular formula C13H33NO3SSi
and a molecular weight of 311.56 g/mol. Its IUPAC name is tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane.
Molecular Properties
| Compound Name | tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane |
| PubChem CID | 139180214 |
| Molecular Formula | C13H33NO3SSi |
| Molecular Weight | 311.56 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane |
| SMILES | CC(C)(C)[NH3+].CC(C)O[Si]([S-])(OC(C)C)OC(C)C |
| InChI | InChI=1S/C9H21O3SSi.C4H11N/c1-7(2)10-14(13,11-8(3)4)12-9(5)6;1-4(2,3)5/h7-9H,1-6H3;5H2,1-3H3/q-1;/p+1 |
| InChIKey | PAYZIFIAPMSFFU-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane?
The IUPAC name of tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane (CID 139180214) is tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane.
What is the SMILES notation for tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane?
The canonical SMILES for tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane is CC(C)(C)[NH3+].CC(C)O[Si]([S-])(OC(C)C)OC(C)C.
What is the InChIKey of tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane?
The InChIKey is PAYZIFIAPMSFFU-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H21O3SSi.C4H11N/c1-7(2)10-14(13,11-8(3)4)12-9(5)6;1-4(2,3)5/h7-9H,1-6H3;5H2,1-3H3/q-1;/p+1.
What are the key properties of tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane?
tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane has a molecular weight of 311.56 g/mol, XLogP of 2.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylazanium;tri(propan-2-yloxy)-sulfidosilane is sourced from PubChem (CID 139180214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).