About CID 159796358
CID 159796358 (PubChem CID 159796358) has the molecular formula C4H10ClOSi
and a molecular weight of 137.66 g/mol.
Molecular Properties
| Compound Name | CID 159796358 |
| PubChem CID | 159796358 |
| Molecular Formula | C4H10ClOSi |
| Molecular Weight | 137.66 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | — |
| SMILES | CC(C)O[Si].CCl |
| InChI | InChI=1S/C3H7OSi.CH3Cl/c1-3(2)4-5;1-2/h3H,1-2H3;1H3 |
| InChIKey | NJFKTVQIFJQMIV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.66 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159796358 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159796358?
The IUPAC name of CID 159796358 (CID 159796358) is not available.
What is the SMILES notation for CID 159796358?
The canonical SMILES for CID 159796358 is CC(C)O[Si].CCl.
What is the InChIKey of CID 159796358?
The InChIKey is NJFKTVQIFJQMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7OSi.CH3Cl/c1-3(2)4-5;1-2/h3H,1-2H3;1H3.
What are the key properties of CID 159796358?
CID 159796358 has a molecular weight of 137.66 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159796358 is sourced from PubChem (CID 159796358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).