About 2-methylpropane;phosphane;dihydrochloride
2-methylpropane;phosphane;dihydrochloride (PubChem CID 173449736) has the molecular formula C4H15Cl2P
and a molecular weight of 165.04 g/mol. Its IUPAC name is 2-methylpropane;phosphane;dihydrochloride.
Molecular Properties
| Compound Name | 2-methylpropane;phosphane;dihydrochloride |
| PubChem CID | 173449736 |
| Molecular Formula | C4H15Cl2P |
| Molecular Weight | 165.04 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 2-methylpropane;phosphane;dihydrochloride |
| SMILES | CC(C)C.Cl.Cl.P |
| InChI | InChI=1S/C4H10.2ClH.H3P/c1-4(2)3;;;/h4H,1-3H3;2*1H;1H3 |
| InChIKey | YQNFLWUDRASDGF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.04 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;phosphane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;phosphane;dihydrochloride?
The IUPAC name of 2-methylpropane;phosphane;dihydrochloride (CID 173449736) is 2-methylpropane;phosphane;dihydrochloride.
What is the SMILES notation for 2-methylpropane;phosphane;dihydrochloride?
The canonical SMILES for 2-methylpropane;phosphane;dihydrochloride is CC(C)C.Cl.Cl.P.
What is the InChIKey of 2-methylpropane;phosphane;dihydrochloride?
The InChIKey is YQNFLWUDRASDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.2ClH.H3P/c1-4(2)3;;;/h4H,1-3H3;2*1H;1H3.
What are the key properties of 2-methylpropane;phosphane;dihydrochloride?
2-methylpropane;phosphane;dihydrochloride has a molecular weight of 165.04 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;phosphane;dihydrochloride is sourced from PubChem (CID 173449736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).