C11H15F2NO — CID 115029046
4,4-difluoro-3-(4-methoxyphenyl)butan-1-amine (PubChem CID 115029046) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 4,4-difluoro-3-(4-methoxyphenyl)butan-1-amine.
| Compound Name | 4,4-difluoro-3-(4-methoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 115029046 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4,4-difluoro-3-(4-methoxyphenyl)butan-1-amine |
| SMILES | COc1ccc(C(CCN)C(F)F)cc1 |
| InChI | InChI=1S/C11H15F2NO/c1-15-9-4-2-8(3-5-9)10(6-7-14)11(12)13/h2-5,10-11H,6-7,14H2,1H3 |
| InChIKey | ULXYFNZIHARRCU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |