C9H12F2NO+ — CID 28973216
[(1S)-2,2-difluoro-1-(4-methoxyphenyl)ethyl]azanium (PubChem CID 28973216) has the molecular formula C9H12F2NO+ and a molecular weight of 188.20 g/mol. Its IUPAC name is [(1S)-2,2-difluoro-1-(4-methoxyphenyl)ethyl]azanium.
| Compound Name | [(1S)-2,2-difluoro-1-(4-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 28973216 |
| Molecular Formula | C9H12F2NO+ |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | [(1S)-2,2-difluoro-1-(4-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc([C@H]([NH3+])C(F)F)cc1 |
| InChI | InChI=1S/C9H11F2NO/c1-13-7-4-2-6(3-5-7)8(12)9(10)11/h2-5,8-9H,12H2,1H3/p+1/t8-/m0/s1 |
| InChIKey | NHQIYKVNUPUUCC-QMMMGPOBSA-O |
| XLogP | 1.24 |
| TPSA | 36.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |