C11H16FN — CID 102430621
(3S,4S)-3-fluoro-4-phenylpentan-1-amine (PubChem CID 102430621) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (3S,4S)-3-fluoro-4-phenylpentan-1-amine.
| Compound Name | (3S,4S)-3-fluoro-4-phenylpentan-1-amine |
|---|---|
| PubChem CID | 102430621 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (3S,4S)-3-fluoro-4-phenylpentan-1-amine |
| SMILES | C[C@@H](c1ccccc1)[C@@H](F)CCN |
| InChI | InChI=1S/C11H16FN/c1-9(11(12)7-8-13)10-5-3-2-4-6-10/h2-6,9,11H,7-8,13H2,1H3/t9-,11-/m0/s1 |
| InChIKey | RCQLZGDEUGJIPJ-ONGXEEELSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |