C16H20N2 — CID 117068143
5-phenyl-5-pyridin-4-ylpentan-1-amine (PubChem CID 117068143) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 5-phenyl-5-pyridin-4-ylpentan-1-amine.
| Compound Name | 5-phenyl-5-pyridin-4-ylpentan-1-amine |
|---|---|
| PubChem CID | 117068143 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-phenyl-5-pyridin-4-ylpentan-1-amine |
| SMILES | NCCCCC(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C16H20N2/c17-11-5-4-8-16(14-6-2-1-3-7-14)15-9-12-18-13-10-15/h1-3,6-7,9-10,12-13,16H,4-5,8,11,17H2 |
| InChIKey | NHFGIESVWWQDJA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|