C18H31N — CID 163630687
N,2,5,5,6-pentamethyl-4-phenylheptan-2-amine (PubChem CID 163630687) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is N,2,5,5,6-pentamethyl-4-phenylheptan-2-amine.
| Compound Name | N,2,5,5,6-pentamethyl-4-phenylheptan-2-amine |
|---|---|
| PubChem CID | 163630687 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N,2,5,5,6-pentamethyl-4-phenylheptan-2-amine |
| SMILES | CNC(C)(C)CC(c1ccccc1)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H31N/c1-14(2)18(5,6)16(13-17(3,4)19-7)15-11-9-8-10-12-15/h8-12,14,16,19H,13H2,1-7H3 |
| InChIKey | HVUMKNSKJOYTDB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |